About 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine
3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117144807) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine.
Analyze 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine (CID 117144807) is 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine is Cc1ccn2c(C3CC3)nnc2c1.
What is the InChIKey of 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is FHWIFVHGEOJBQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-7-4-5-13-9(6-7)11-12-10(13)8-2-3-8/h4-6,8H,2-3H2,1H3.
What are the key properties of 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine?
3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 173.22 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-7-methyl-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 117144807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).