C13H15ClN2O2S — CID 117132170
2-[(5-chloroimidazo[1,2-a]pyridin-2-yl)methyl]thiane 1,1-dioxide (PubChem CID 117132170) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.79 g/mol. Its IUPAC name is 2-[(5-chloroimidazo[1,2-a]pyridin-2-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[(5-chloroimidazo[1,2-a]pyridin-2-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117132170 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-[(5-chloroimidazo[1,2-a]pyridin-2-yl)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1Cc1cn2c(Cl)cccc2n1 |
| InChI | InChI=1S/C13H15ClN2O2S/c14-12-5-3-6-13-15-10(9-16(12)13)8-11-4-1-2-7-19(11,17)18/h3,5-6,9,11H,1-2,4,7-8H2 |
| InChIKey | SHNZVZGQDJBFSH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|