C8H7Br2ClN2 — CID 137347572
2-(bromomethyl)-5-chloroimidazo[1,2-a]pyridine;hydrobromide (PubChem CID 137347572) has the molecular formula C8H7Br2ClN2 and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(bromomethyl)-5-chloroimidazo[1,2-a]pyridine;hydrobromide.
| Compound Name | 2-(bromomethyl)-5-chloroimidazo[1,2-a]pyridine;hydrobromide |
|---|---|
| PubChem CID | 137347572 |
| Molecular Formula | C8H7Br2ClN2 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 323.87 |
| IUPAC Name | 2-(bromomethyl)-5-chloroimidazo[1,2-a]pyridine;hydrobromide |
| SMILES | Br.Clc1cccc2nc(CBr)cn12 |
| InChI | InChI=1S/C8H6BrClN2.BrH/c9-4-6-5-12-7(10)2-1-3-8(12)11-6;/h1-3,5H,4H2;1H |
| InChIKey | KHRVQDYNJLDVEP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|