C7H5ClN2O — CID 105433971
5-chloroimidazo[1,2-a]pyridin-2-ol (PubChem CID 105433971) has the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. Its IUPAC name is 5-chloroimidazo[1,2-a]pyridin-2-ol.
| Compound Name | 5-chloroimidazo[1,2-a]pyridin-2-ol |
|---|---|
| PubChem CID | 105433971 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 5-chloroimidazo[1,2-a]pyridin-2-ol |
| SMILES | Oc1cn2c(Cl)cccc2n1 |
| InChI | InChI=1S/C7H5ClN2O/c8-5-2-1-3-6-9-7(11)4-10(5)6/h1-4,11H |
| InChIKey | NRGHXHLYTJSTIK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|