C12H13ClN2O2 — CID 135395941
propan-2-yl 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)acetate (PubChem CID 135395941) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is propan-2-yl 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)acetate.
| Compound Name | propan-2-yl 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)acetate |
|---|---|
| PubChem CID | 135395941 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | propan-2-yl 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)acetate |
| SMILES | CC(C)OC(=O)Cc1cn2c(Cl)cccc2n1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-8(2)17-12(16)6-9-7-15-10(13)4-3-5-11(15)14-9/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | MXWXNLGYNUDSGP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|