C11H14ClN3 — CID 117133330
2-(5-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-dimethylethanamine (PubChem CID 117133330) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 117133330 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-(5-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1cn2c(Cl)cccc2n1 |
| InChI | InChI=1S/C11H14ClN3/c1-14(2)7-6-9-8-15-10(12)4-3-5-11(15)13-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | JDGZVSPXMHCHMG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|