C14H18ClN3 — CID 117132317
5-chloro-2-[(1-methylpiperidin-3-yl)methyl]imidazo[1,2-a]pyridine (PubChem CID 117132317) has the molecular formula C14H18ClN3 and a molecular weight of 263.77 g/mol. Its IUPAC name is 5-chloro-2-[(1-methylpiperidin-3-yl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 5-chloro-2-[(1-methylpiperidin-3-yl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117132317 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-chloro-2-[(1-methylpiperidin-3-yl)methyl]imidazo[1,2-a]pyridine |
| SMILES | CN1CCCC(Cc2cn3c(Cl)cccc3n2)C1 |
| InChI | InChI=1S/C14H18ClN3/c1-17-7-3-4-11(9-17)8-12-10-18-13(15)5-2-6-14(18)16-12/h2,5-6,10-11H,3-4,7-9H2,1H3 |
| InChIKey | RTBAOMVVPYTLSZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|