C12H17BrN2 — CID 124641722
2-bromo-6-[[(3S)-1-methylpiperidin-3-yl]methyl]pyridine (PubChem CID 124641722) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-bromo-6-[[(3S)-1-methylpiperidin-3-yl]methyl]pyridine.
| Compound Name | 2-bromo-6-[[(3S)-1-methylpiperidin-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 124641722 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-bromo-6-[[(3S)-1-methylpiperidin-3-yl]methyl]pyridine |
| SMILES | CN1CCC[C@@H](Cc2cccc(Br)n2)C1 |
| InChI | InChI=1S/C12H17BrN2/c1-15-7-3-4-10(9-15)8-11-5-2-6-12(13)14-11/h2,5-6,10H,3-4,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | KINSITRTXMZDAK-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|