C17H24N4 — CID 124976617
2-methyl-6-[[(3R)-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyridine (PubChem CID 124976617) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 2-methyl-6-[[(3R)-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyridine.
| Compound Name | 2-methyl-6-[[(3R)-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 124976617 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-methyl-6-[[(3R)-1-[(1-methylpyrazol-3-yl)methyl]piperidin-3-yl]methyl]pyridine |
| SMILES | Cc1cccc(C[C@H]2CCCN(Cc3ccn(C)n3)C2)n1 |
| InChI | InChI=1S/C17H24N4/c1-14-5-3-7-16(18-14)11-15-6-4-9-21(12-15)13-17-8-10-20(2)19-17/h3,5,7-8,10,15H,4,6,9,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | LGRPEWJOEBQMMA-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |