C16H25N3O2S — CID 125004087
2-methyl-6-[[(3R)-1-pyrrolidin-1-ylsulfonylpiperidin-3-yl]methyl]pyridine (PubChem CID 125004087) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-methyl-6-[[(3R)-1-pyrrolidin-1-ylsulfonylpiperidin-3-yl]methyl]pyridine.
| Compound Name | 2-methyl-6-[[(3R)-1-pyrrolidin-1-ylsulfonylpiperidin-3-yl]methyl]pyridine |
|---|---|
| PubChem CID | 125004087 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-methyl-6-[[(3R)-1-pyrrolidin-1-ylsulfonylpiperidin-3-yl]methyl]pyridine |
| SMILES | Cc1cccc(C[C@H]2CCCN(S(=O)(=O)N3CCCC3)C2)n1 |
| InChI | InChI=1S/C16H25N3O2S/c1-14-6-4-8-16(17-14)12-15-7-5-11-19(13-15)22(20,21)18-9-2-3-10-18/h4,6,8,15H,2-3,5,7,9-13H2,1H3/t15-/m1/s1 |
| InChIKey | SWCXZQYRBWLIBS-OAHLLOKOSA-N |
| XLogP | 1.99 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |