C15H23N3O2S — CID 110096214
2-[(1-pyrrolidin-1-ylsulfonylpiperidin-3-yl)methyl]pyridine (PubChem CID 110096214) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[(1-pyrrolidin-1-ylsulfonylpiperidin-3-yl)methyl]pyridine.
| Compound Name | 2-[(1-pyrrolidin-1-ylsulfonylpiperidin-3-yl)methyl]pyridine |
|---|---|
| PubChem CID | 110096214 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[(1-pyrrolidin-1-ylsulfonylpiperidin-3-yl)methyl]pyridine |
| SMILES | O=S(=O)(N1CCCC1)N1CCCC(Cc2ccccn2)C1 |
| InChI | InChI=1S/C15H23N3O2S/c19-21(20,17-9-3-4-10-17)18-11-5-6-14(13-18)12-15-7-1-2-8-16-15/h1-2,7-8,14H,3-6,9-13H2 |
| InChIKey | FRLKDYMDLWAWAZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |