C13H10ClN3O — CID 117255772
5-chloro-2-(pyridin-3-yloxymethyl)imidazo[1,2-a]pyridine (PubChem CID 117255772) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 5-chloro-2-(pyridin-3-yloxymethyl)imidazo[1,2-a]pyridine.
| Compound Name | 5-chloro-2-(pyridin-3-yloxymethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117255772 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-chloro-2-(pyridin-3-yloxymethyl)imidazo[1,2-a]pyridine |
| SMILES | Clc1cccc2nc(COc3cccnc3)cn12 |
| InChI | InChI=1S/C13H10ClN3O/c14-12-4-1-5-13-16-10(8-17(12)13)9-18-11-3-2-6-15-7-11/h1-8H,9H2 |
| InChIKey | QGOVYUMTQNRXGR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|