C11H11ClN2S — CID 117131140
5-chloro-2-(thiolan-3-yl)imidazo[1,2-a]pyridine (PubChem CID 117131140) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is 5-chloro-2-(thiolan-3-yl)imidazo[1,2-a]pyridine.
| Compound Name | 5-chloro-2-(thiolan-3-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117131140 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 5-chloro-2-(thiolan-3-yl)imidazo[1,2-a]pyridine |
| SMILES | Clc1cccc2nc(C3CCSC3)cn12 |
| InChI | InChI=1S/C11H11ClN2S/c12-10-2-1-3-11-13-9(6-14(10)11)8-4-5-15-7-8/h1-3,6,8H,4-5,7H2 |
| InChIKey | INGZRBUEHLRBCA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|