C14H16N2O3S — CID 117136819
2-[(1,1-dioxothian-2-yl)methyl]imidazo[1,2-a]pyridine-8-carbaldehyde (PubChem CID 117136819) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-2-yl)methyl]imidazo[1,2-a]pyridine-8-carbaldehyde.
| Compound Name | 2-[(1,1-dioxothian-2-yl)methyl]imidazo[1,2-a]pyridine-8-carbaldehyde |
|---|---|
| PubChem CID | 117136819 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(1,1-dioxothian-2-yl)methyl]imidazo[1,2-a]pyridine-8-carbaldehyde |
| SMILES | O=Cc1cccn2cc(CC3CCCCS3(=O)=O)nc12 |
| InChI | InChI=1S/C14H16N2O3S/c17-10-11-4-3-6-16-9-12(15-14(11)16)8-13-5-1-2-7-20(13,18)19/h3-4,6,9-10,13H,1-2,5,7-8H2 |
| InChIKey | ZBPUZWTUVPCWRT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|