C7H11N3O3S — CID 136999496
3-(1,1-dioxothian-4-yl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136999496) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(1,1-dioxothian-4-yl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136999496 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(C2CCS(=O)(=O)CC2)[nH]1 |
| InChI | InChI=1S/C7H11N3O3S/c11-7-8-6(9-10-7)5-1-3-14(12,13)4-2-5/h5H,1-4H2,(H2,8,9,10,11) |
| InChIKey | QWAYZUHCJPLRBH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |