C9H15N3O2S — CID 115037328
[2-(1,1-dioxothian-4-yl)-1H-imidazol-5-yl]methanamine (PubChem CID 115037328) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is [2-(1,1-dioxothian-4-yl)-1H-imidazol-5-yl]methanamine.
| Compound Name | [2-(1,1-dioxothian-4-yl)-1H-imidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 115037328 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | [2-(1,1-dioxothian-4-yl)-1H-imidazol-5-yl]methanamine |
| SMILES | NCc1cnc(C2CCS(=O)(=O)CC2)[nH]1 |
| InChI | InChI=1S/C9H15N3O2S/c10-5-8-6-11-9(12-8)7-1-3-15(13,14)4-2-7/h6-7H,1-5,10H2,(H,11,12) |
| InChIKey | OVCRGRRHFHQVGZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |