C5H10N4 — CID 54546826
[2-(aminomethyl)-1H-imidazol-5-yl]methanamine (PubChem CID 54546826) has the molecular formula C5H10N4 and a molecular weight of 126.16 g/mol. Its IUPAC name is [2-(aminomethyl)-1H-imidazol-5-yl]methanamine.
| Compound Name | [2-(aminomethyl)-1H-imidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 54546826 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | [2-(aminomethyl)-1H-imidazol-5-yl]methanamine |
| SMILES | NCc1cnc(CN)[nH]1 |
| InChI | InChI=1S/C5H10N4/c6-1-4-3-8-5(2-7)9-4/h3H,1-2,6-7H2,(H,8,9) |
| InChIKey | ZHCJNKHIDUZZTB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |