C11H11F2N3O — CID 82292430
[2-[(3,4-difluorophenoxy)methyl]-1H-imidazol-5-yl]methanamine (PubChem CID 82292430) has the molecular formula C11H11F2N3O and a molecular weight of 239.22 g/mol. Its IUPAC name is [2-[(3,4-difluorophenoxy)methyl]-1H-imidazol-5-yl]methanamine.
| Compound Name | [2-[(3,4-difluorophenoxy)methyl]-1H-imidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82292430 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [2-[(3,4-difluorophenoxy)methyl]-1H-imidazol-5-yl]methanamine |
| SMILES | NCc1cnc(COc2ccc(F)c(F)c2)[nH]1 |
| InChI | InChI=1S/C11H11F2N3O/c12-9-2-1-8(3-10(9)13)17-6-11-15-5-7(4-14)16-11/h1-3,5H,4,6,14H2,(H,15,16) |
| InChIKey | QGFPMZYWIXXYCF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |