C12H13ClFN3O — CID 95473112
2-[2-[(2-chloro-4-fluorophenoxy)methyl]-1H-imidazol-5-yl]ethanamine (PubChem CID 95473112) has the molecular formula C12H13ClFN3O and a molecular weight of 269.71 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-fluorophenoxy)methyl]-1H-imidazol-5-yl]ethanamine.
| Compound Name | 2-[2-[(2-chloro-4-fluorophenoxy)methyl]-1H-imidazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 95473112 |
| Molecular Formula | C12H13ClFN3O |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-[2-[(2-chloro-4-fluorophenoxy)methyl]-1H-imidazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(COc2ccc(F)cc2Cl)[nH]1 |
| InChI | InChI=1S/C12H13ClFN3O/c13-10-5-8(14)1-2-11(10)18-7-12-16-6-9(17-12)3-4-15/h1-2,5-6H,3-4,7,15H2,(H,16,17) |
| InChIKey | SLYAGEZKQXFVIK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |