About 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide
3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide (PubChem CID 115338666) has the molecular formula C14H14BrNO2S2
and a molecular weight of 372.31 g/mol. Its IUPAC name is 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide |
| PubChem CID | 115338666 |
| Molecular Formula | C14H14BrNO2S2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide |
| SMILES | Cc1sc(C2CCS(=O)(=O)C2)nc1-c1ccccc1Br |
| InChI | InChI=1S/C14H14BrNO2S2/c1-9-13(11-4-2-3-5-12(11)15)16-14(19-9)10-6-7-20(17,18)8-10/h2-5,10H,6-8H2,1H3 |
| InChIKey | PMSIKISLFVEVAG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide?
The IUPAC name of 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide (CID 115338666) is 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide is Cc1sc(C2CCS(=O)(=O)C2)nc1-c1ccccc1Br.
What is the InChIKey of 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide?
The InChIKey is PMSIKISLFVEVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO2S2/c1-9-13(11-4-2-3-5-12(11)15)16-14(19-9)10-6-7-20(17,18)8-10/h2-5,10H,6-8H2,1H3.
What are the key properties of 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide?
3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide has a molecular weight of 372.31 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-bromophenyl)-5-methyl-1,3-thiazol-2-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 115338666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).