C11H16ClNO3S — CID 104522599
2-[2-(3-chloropropyl)-1,3-oxazol-5-yl]thiane 1,1-dioxide (PubChem CID 104522599) has the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. Its IUPAC name is 2-[2-(3-chloropropyl)-1,3-oxazol-5-yl]thiane 1,1-dioxide.
| Compound Name | 2-[2-(3-chloropropyl)-1,3-oxazol-5-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104522599 |
| Molecular Formula | C11H16ClNO3S |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[2-(3-chloropropyl)-1,3-oxazol-5-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1c1cnc(CCCCl)o1 |
| InChI | InChI=1S/C11H16ClNO3S/c12-6-3-5-11-13-8-9(16-11)10-4-1-2-7-17(10,14)15/h8,10H,1-7H2 |
| InChIKey | UVEOSEDXHJXMFA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|