C10H14ClNO — CID 164660300
2-(2-chloroethyl)-5-(3-methylcyclobutyl)-1,3-oxazole (PubChem CID 164660300) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(3-methylcyclobutyl)-1,3-oxazole.
| Compound Name | 2-(2-chloroethyl)-5-(3-methylcyclobutyl)-1,3-oxazole |
|---|---|
| PubChem CID | 164660300 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(2-chloroethyl)-5-(3-methylcyclobutyl)-1,3-oxazole |
| SMILES | CC1CC(c2cnc(CCCl)o2)C1 |
| InChI | InChI=1S/C10H14ClNO/c1-7-4-8(5-7)9-6-12-10(13-9)2-3-11/h6-8H,2-5H2,1H3 |
| InChIKey | OCUAVKOEARSMMA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|