C10H16N2O — CID 164660372
2-[5-(3-methylcyclobutyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 164660372) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[5-(3-methylcyclobutyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(3-methylcyclobutyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 164660372 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-[5-(3-methylcyclobutyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CC1CC(c2cnc(CCN)o2)C1 |
| InChI | InChI=1S/C10H16N2O/c1-7-4-8(5-7)9-6-12-10(13-9)2-3-11/h6-8H,2-5,11H2,1H3 |
| InChIKey | RNYJJCJRVDOKIV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |