C9H14N2O2 — CID 79763380
[5-(2-methyloxolan-3-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 79763380) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is [5-(2-methyloxolan-3-yl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(2-methyloxolan-3-yl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 79763380 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | [5-(2-methyloxolan-3-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | CC1OCCC1c1cnc(CN)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-6-7(2-3-12-6)8-5-11-9(4-10)13-8/h5-7H,2-4,10H2,1H3 |
| InChIKey | VZGPLMFYCRPRAY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |