C10H16N2O2 — CID 65178634
1-[5-(oxolan-2-ylmethyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65178634) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-[5-(oxolan-2-ylmethyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 1-[5-(oxolan-2-ylmethyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65178634 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-[5-(oxolan-2-ylmethyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CC(N)c1ncc(CC2CCCO2)o1 |
| InChI | InChI=1S/C10H16N2O2/c1-7(11)10-12-6-9(14-10)5-8-3-2-4-13-8/h6-8H,2-5,11H2,1H3 |
| InChIKey | REOODDOPCZZBMB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |