C12H20N2O — CID 65178744
1-[5-(2-cyclopentylethyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65178744) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[5-(2-cyclopentylethyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 1-[5-(2-cyclopentylethyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 65178744 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[5-(2-cyclopentylethyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | CC(N)c1ncc(CCC2CCCC2)o1 |
| InChI | InChI=1S/C12H20N2O/c1-9(13)12-14-8-11(15-12)7-6-10-4-2-3-5-10/h8-10H,2-7,13H2,1H3 |
| InChIKey | UPLQROYPACZLAA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |