C12H14N2O2 — CID 68695556
2-[[(2S)-oxolan-2-yl]methyl]furo[2,3-b]pyridin-4-amine (PubChem CID 68695556) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methyl]furo[2,3-b]pyridin-4-amine.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methyl]furo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 68695556 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methyl]furo[2,3-b]pyridin-4-amine |
| SMILES | Nc1ccnc2oc(C[C@@H]3CCCO3)cc12 |
| InChI | InChI=1S/C12H14N2O2/c13-11-3-4-14-12-10(11)7-9(16-12)6-8-2-1-5-15-8/h3-4,7-8H,1-2,5-6H2,(H2,13,14)/t8-/m0/s1 |
| InChIKey | RGNAJUWJVOGAQL-QMMMGPOBSA-N |
| XLogP | 2.13 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |