C11H13NO2 — CID 66930762
2-(oxolan-2-ylmethyl)-4H-furo[3,2-b]pyrrole (PubChem CID 66930762) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-4H-furo[3,2-b]pyrrole.
| Compound Name | 2-(oxolan-2-ylmethyl)-4H-furo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 66930762 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-4H-furo[3,2-b]pyrrole |
| SMILES | c1cc2oc(CC3CCCO3)cc2[nH]1 |
| InChI | InChI=1S/C11H13NO2/c1-2-8(13-5-1)6-9-7-10-11(14-9)3-4-12-10/h3-4,7-8,12H,1-2,5-6H2 |
| InChIKey | FTWVIOSRBRMSRG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |