C13H20N2O — CID 65165457
4-[4-(oxolan-2-yl)butyl]pyridin-2-amine (PubChem CID 65165457) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 4-[4-(oxolan-2-yl)butyl]pyridin-2-amine.
| Compound Name | 4-[4-(oxolan-2-yl)butyl]pyridin-2-amine |
|---|---|
| PubChem CID | 65165457 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 4-[4-(oxolan-2-yl)butyl]pyridin-2-amine |
| SMILES | Nc1cc(CCCCC2CCCO2)ccn1 |
| InChI | InChI=1S/C13H20N2O/c14-13-10-11(7-8-15-13)4-1-2-5-12-6-3-9-16-12/h7-8,10,12H,1-6,9H2,(H2,14,15) |
| InChIKey | LJERNQKLXNBYDB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|