C17H27N3O3S — CID 110113962
4-[2-(4-cyclohexylsulfonylmorpholin-2-yl)ethyl]pyridin-2-amine (PubChem CID 110113962) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[2-(4-cyclohexylsulfonylmorpholin-2-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-(4-cyclohexylsulfonylmorpholin-2-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 110113962 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 4-[2-(4-cyclohexylsulfonylmorpholin-2-yl)ethyl]pyridin-2-amine |
| SMILES | Nc1cc(CCC2CN(S(=O)(=O)C3CCCCC3)CCO2)ccn1 |
| InChI | InChI=1S/C17H27N3O3S/c18-17-12-14(8-9-19-17)6-7-15-13-20(10-11-23-15)24(21,22)16-4-2-1-3-5-16/h8-9,12,15-16H,1-7,10-11,13H2,(H2,18,19) |
| InChIKey | NBPIUIFCAGSJGL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |