C16H20N4O3S — CID 124945564
4-[2-[(2S)-4-pyridin-3-ylsulfonylmorpholin-2-yl]ethyl]pyridin-2-amine (PubChem CID 124945564) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-[2-[(2S)-4-pyridin-3-ylsulfonylmorpholin-2-yl]ethyl]pyridin-2-amine.
| Compound Name | 4-[2-[(2S)-4-pyridin-3-ylsulfonylmorpholin-2-yl]ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 124945564 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-[2-[(2S)-4-pyridin-3-ylsulfonylmorpholin-2-yl]ethyl]pyridin-2-amine |
| SMILES | Nc1cc(CC[C@H]2CN(S(=O)(=O)c3cccnc3)CCO2)ccn1 |
| InChI | InChI=1S/C16H20N4O3S/c17-16-10-13(5-7-19-16)3-4-14-12-20(8-9-23-14)24(21,22)15-2-1-6-18-11-15/h1-2,5-7,10-11,14H,3-4,8-9,12H2,(H2,17,19)/t14-/m0/s1 |
| InChIKey | BRXFFKMCWYZPLG-AWEZNQCLSA-N |
| XLogP | 1.08 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |