C12H21Cl2N3 — CID 167995844
4-(2-piperidin-3-ylethyl)pyridin-2-amine;dihydrochloride (PubChem CID 167995844) has the molecular formula C12H21Cl2N3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-(2-piperidin-3-ylethyl)pyridin-2-amine;dihydrochloride.
| Compound Name | 4-(2-piperidin-3-ylethyl)pyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 167995844 |
| Molecular Formula | C12H21Cl2N3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(2-piperidin-3-ylethyl)pyridin-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cc(CCC2CCCNC2)ccn1 |
| InChI | InChI=1S/C12H19N3.2ClH/c13-12-8-10(5-7-15-12)3-4-11-2-1-6-14-9-11;;/h5,7-8,11,14H,1-4,6,9H2,(H2,13,15);2*1H |
| InChIKey | ADGKBQPQUWSDMR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |