C15H22N2S — CID 116999243
6-(2-piperidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 116999243) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 6-(2-piperidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 6-(2-piperidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 116999243 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-(2-piperidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | c1cc2c(cc1CCC1CCCNC1)NCCS2 |
| InChI | InChI=1S/C15H22N2S/c1-2-13(11-16-7-1)4-3-12-5-6-15-14(10-12)17-8-9-18-15/h5-6,10,13,16-17H,1-4,7-9,11H2 |
| InChIKey | FEPKBWSJBAOHPO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |