C14H20N2S — CID 116999039
7-(2-pyrrolidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 116999039) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 7-(2-pyrrolidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 7-(2-pyrrolidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 116999039 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 7-(2-pyrrolidin-3-ylethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | c1cc2c(cc1CCC1CCNC1)SCCN2 |
| InChI | InChI=1S/C14H20N2S/c1(2-12-5-6-15-10-12)11-3-4-13-14(9-11)17-8-7-16-13/h3-4,9,12,15-16H,1-2,5-8,10H2 |
| InChIKey | JUHWYQIGTVCCJU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |