C15H22N2 — CID 116998012
5-(2-piperidin-4-ylethyl)-2,3-dihydro-1H-indole (PubChem CID 116998012) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 5-(2-piperidin-4-ylethyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(2-piperidin-4-ylethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116998012 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 5-(2-piperidin-4-ylethyl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1CCC1CCNCC1)CCN2 |
| InChI | InChI=1S/C15H22N2/c1(12-5-8-16-9-6-12)2-13-3-4-15-14(11-13)7-10-17-15/h3-4,11-12,16-17H,1-2,5-10H2 |
| InChIKey | TWZOPYOVULDYPK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |