C17H25N — CID 114192887
6-(2-cyclohexylethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 114192887) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-(2-cyclohexylethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(2-cyclohexylethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 114192887 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-(2-cyclohexylethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1CCC1CCCCC1)CCCN2 |
| InChI | InChI=1S/C17H25N/c1-2-5-14(6-3-1)8-9-15-10-11-17-16(13-15)7-4-12-18-17/h10-11,13-14,18H,1-9,12H2 |
| InChIKey | BKHPBSGOIDTKKB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |