C15H23N — CID 106778864
6-(3,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106778864) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 6-(3,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(3,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106778864 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 6-(3,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC(C)(C)CCc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C15H23N/c1-15(2,3)9-8-12-6-7-14-13(11-12)5-4-10-16-14/h6-7,11,16H,4-5,8-10H2,1-3H3 |
| InChIKey | ADJDFRZSUSPBOO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |