C14H19N — CID 106779249
6-(cyclobutylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106779249) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 6-(cyclobutylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(cyclobutylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106779249 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 6-(cyclobutylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1CC1CCC1)CCCN2 |
| InChI | InChI=1S/C14H19N/c1-3-11(4-1)9-12-6-7-14-13(10-12)5-2-8-15-14/h6-7,10-11,15H,1-5,8-9H2 |
| InChIKey | FQACFPRBBVRTHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |