C12H18N2 — CID 115105456
3-(2,3-dihydro-1H-indol-5-yl)-N-methylpropan-1-amine (PubChem CID 115105456) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-5-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,3-dihydro-1H-indol-5-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 115105456 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-5-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C12H18N2/c1-13-7-2-3-10-4-5-12-11(9-10)6-8-14-12/h4-5,9,13-14H,2-3,6-8H2,1H3 |
| InChIKey | GDNYYBVOCLJOEJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|