C18H30N2 — CID 107815618
N-(2,3-dihydro-1H-indol-5-ylmethyl)-7-methyloctan-1-amine (PubChem CID 107815618) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-5-ylmethyl)-7-methyloctan-1-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-5-ylmethyl)-7-methyloctan-1-amine |
|---|---|
| PubChem CID | 107815618 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-5-ylmethyl)-7-methyloctan-1-amine |
| SMILES | CC(C)CCCCCCNCc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C18H30N2/c1-15(2)7-5-3-4-6-11-19-14-16-8-9-18-17(13-16)10-12-20-18/h8-9,13,15,19-20H,3-7,10-12,14H2,1-2H3 |
| InChIKey | WSCGTEXBNXNOSQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|