4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid

C14H20N2O2 — CID 82256904

IUPAC4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid
SMILESO=C(O)CCCNCCc1ccc2c(c1)CCN2
InChIInChI=1S/C14H20N2O2/c17-14(18)2-1-7-15-8-5-11-3-4-13-12(10-11)6-9-16-13/h3-4,10,15-16H,1-2,5-9H2,(H,17,18)
InChIKeySZXFPLOTFSMIPX-UHFFFAOYSA-N
MW248.33 g/mol
LogP1.65
Rot. Bonds7

About 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid

4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid (PubChem CID 82256904) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid.

Molecular Properties

Compound Name4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid
PubChem CID82256904
Molecular FormulaC14H20N2O2
Molecular Weight248.33 g/mol
Exact Mass248.15
IUPAC Name4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid
SMILESO=C(O)CCCNCCc1ccc2c(c1)CCN2
InChIInChI=1S/C14H20N2O2/c17-14(18)2-1-7-15-8-5-11-3-4-13-12(10-11)6-9-16-13/h3-4,10,15-16H,1-2,5-9H2,(H,17,18)
InChIKeySZXFPLOTFSMIPX-UHFFFAOYSA-N
XLogP1.65
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.33
LogP ≤ 51.65
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid?
The IUPAC name of 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid (CID 82256904) is 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid.
What is the SMILES notation for 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid?
The canonical SMILES for 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid is O=C(O)CCCNCCc1ccc2c(c1)CCN2.
What is the InChIKey of 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid?
The InChIKey is SZXFPLOTFSMIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c17-14(18)2-1-7-15-8-5-11-3-4-13-12(10-11)6-9-16-13/h3-4,10,15-16H,1-2,5-9H2,(H,17,18).
What are the key properties of 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid?
4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid has a molecular weight of 248.33 g/mol, XLogP of 1.65, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,3-dihydro-1H-indol-5-yl)ethylamino]butanoic acid is sourced from PubChem (CID 82256904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).