C16H15NO2 — CID 82039136
2-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]acetic acid (PubChem CID 82039136) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 82039136 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc3c(c2)CCN3)cc1 |
| InChI | InChI=1S/C16H15NO2/c18-16(19)9-11-1-3-12(4-2-11)13-5-6-15-14(10-13)7-8-17-15/h1-6,10,17H,7-9H2,(H,18,19) |
| InChIKey | SYMPIFVBWMJLEH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |