C17H17NO2 — CID 39226276
2-[4-(1,2,3,4-tetrahydroquinolin-6-yl)phenyl]acetic acid (PubChem CID 39226276) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[4-(1,2,3,4-tetrahydroquinolin-6-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(1,2,3,4-tetrahydroquinolin-6-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 39226276 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[4-(1,2,3,4-tetrahydroquinolin-6-yl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc3c(c2)CCCN3)cc1 |
| InChI | InChI=1S/C17H17NO2/c19-17(20)10-12-3-5-13(6-4-12)14-7-8-16-15(11-14)2-1-9-18-16/h3-8,11,18H,1-2,9-10H2,(H,19,20) |
| InChIKey | KLGAKABMYGDEEO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |