C16H22ClN5 — CID 71298941
N-[4-(2-piperidin-3-ylethyl)-2-pyridinyl]pyrazin-2-amine;hydrochloride (PubChem CID 71298941) has the molecular formula C16H22ClN5 and a molecular weight of 319.84 g/mol. Its IUPAC name is N-[4-(2-piperidin-3-ylethyl)-2-pyridinyl]pyrazin-2-amine;hydrochloride.
| Compound Name | N-[4-(2-piperidin-3-ylethyl)-2-pyridinyl]pyrazin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71298941 |
| Molecular Formula | C16H22ClN5 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[4-(2-piperidin-3-ylethyl)-2-pyridinyl]pyrazin-2-amine;hydrochloride |
| SMILES | Cl.c1cnc(Nc2cc(CCC3CCCNC3)ccn2)cn1 |
| InChI | InChI=1S/C16H21N5.ClH/c1-2-14(11-17-6-1)4-3-13-5-7-19-15(10-13)21-16-12-18-8-9-20-16;/h5,7-10,12,14,17H,1-4,6,11H2,(H,19,20,21);1H |
| InChIKey | HKCJUKUCPHSPTK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |