C11H15NS2 — CID 116999259
3-(3,4-dihydro-2H-1,4-benzothiazin-6-yl)propane-1-thiol (PubChem CID 116999259) has the molecular formula C11H15NS2 and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,4-benzothiazin-6-yl)propane-1-thiol.
| Compound Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-6-yl)propane-1-thiol |
|---|---|
| PubChem CID | 116999259 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,4-benzothiazin-6-yl)propane-1-thiol |
| SMILES | SCCCc1ccc2c(c1)NCCS2 |
| InChI | InChI=1S/C11H15NS2/c13-6-1-2-9-3-4-11-10(8-9)12-5-7-14-11/h3-4,8,12-13H,1-2,5-7H2 |
| InChIKey | UWVARAWBCWFUEZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|