C10H17N3 — CID 84732247
3-[2-(1H-imidazol-2-yl)ethyl]piperidine (PubChem CID 84732247) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-[2-(1H-imidazol-2-yl)ethyl]piperidine.
| Compound Name | 3-[2-(1H-imidazol-2-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 84732247 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-[2-(1H-imidazol-2-yl)ethyl]piperidine |
| SMILES | c1c[nH]c(CCC2CCCNC2)n1 |
| InChI | InChI=1S/C10H17N3/c1-2-9(8-11-5-1)3-4-10-12-6-7-13-10/h6-7,9,11H,1-5,8H2,(H,12,13) |
| InChIKey | BOXHUYXFQSHYJS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |