C10H15ClN2O2S2 — CID 104522733
2-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]thiane 1,1-dioxide (PubChem CID 104522733) has the molecular formula C10H15ClN2O2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]thiane 1,1-dioxide.
| Compound Name | 2-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104522733 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[5-(3-chloropropyl)-1,3,4-thiadiazol-2-yl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1c1nnc(CCCCl)s1 |
| InChI | InChI=1S/C10H15ClN2O2S2/c11-6-3-5-9-12-13-10(16-9)8-4-1-2-7-17(8,14)15/h8H,1-7H2 |
| InChIKey | QUHUKNSOOCJOHM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|