C13H21ClN2S — CID 114459289
2-(3-chloropropyl)-5-(cycloheptylmethyl)-1,3,4-thiadiazole (PubChem CID 114459289) has the molecular formula C13H21ClN2S and a molecular weight of 272.84 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(cycloheptylmethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(cycloheptylmethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 114459289 |
| Molecular Formula | C13H21ClN2S |
| Molecular Weight | 272.84 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(3-chloropropyl)-5-(cycloheptylmethyl)-1,3,4-thiadiazole |
| SMILES | ClCCCc1nnc(CC2CCCCCC2)s1 |
| InChI | InChI=1S/C13H21ClN2S/c14-9-5-8-12-15-16-13(17-12)10-11-6-3-1-2-4-7-11/h11H,1-10H2 |
| InChIKey | RETNZEOWRNSTES-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.84 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|