C11H19N3S — CID 10331253
5-(2-cycloheptylethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 10331253) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 5-(2-cycloheptylethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-cycloheptylethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 10331253 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-(2-cycloheptylethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCC2CCCCCC2)s1 |
| InChI | InChI=1S/C11H19N3S/c12-11-14-13-10(15-11)8-7-9-5-3-1-2-4-6-9/h9H,1-8H2,(H2,12,14) |
| InChIKey | MIKBYSODXJCSKK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |