About 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile
5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile (PubChem CID 157478754) has the molecular formula C19H32N4S
and a molecular weight of 348.56 g/mol. Its IUPAC name is 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile.
Molecular Properties
| Compound Name | 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile |
| PubChem CID | 157478754 |
| Molecular Formula | C19H32N4S |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile |
| SMILES | N#CCCC1CCCCC1.Nc1nnc(CCC2CCCCC2)s1 |
| InChI | InChI=1S/C10H17N3S.C9H15N/c11-10-13-12-9(14-10)7-6-8-4-2-1-3-5-8;10-8-4-7-9-5-2-1-3-6-9/h8H,1-7H2,(H2,11,13);9H,1-7H2 |
| InChIKey | BVXIKVYPWYOGQF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile?
The IUPAC name of 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile (CID 157478754) is 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile.
What is the SMILES notation for 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile?
The canonical SMILES for 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile is N#CCCC1CCCCC1.Nc1nnc(CCC2CCCCC2)s1.
What is the InChIKey of 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile?
The InChIKey is BVXIKVYPWYOGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S.C9H15N/c11-10-13-12-9(14-10)7-6-8-4-2-1-3-5-8;10-8-4-7-9-5-2-1-3-6-9/h8H,1-7H2,(H2,11,13);9H,1-7H2.
What are the key properties of 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile?
5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile has a molecular weight of 348.56 g/mol, XLogP of 5.50, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-cyclohexylethyl)-1,3,4-thiadiazol-2-amine;3-cyclohexylpropanenitrile is sourced from PubChem (CID 157478754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).